C28H30N6O3S — CID 74982793
N-[6-[4-[5-[[2-[3-(1-hydroxyethyl)phenyl]acetyl]amino]-1,3,4-thiadiazol-2-yl]butyl]pyridazin-3-yl]-2-phenylacetamide (PubChem CID 74982793) has the molecular formula C28H30N6O3S and a molecular weight of 530.65 g/mol. Its IUPAC name is N-[6-[4-[5-[[2-[3-(1-hydroxyethyl)phenyl]acetyl]amino]-1,3,4-thiadiazol-2-yl]butyl]pyridazin-3-yl]-2-phenylacetamide.
| Compound Name | N-[6-[4-[5-[[2-[3-(1-hydroxyethyl)phenyl]acetyl]amino]-1,3,4-thiadiazol-2-yl]butyl]pyridazin-3-yl]-2-phenylacetamide |
|---|---|
| PubChem CID | 74982793 |
| Molecular Formula | C28H30N6O3S |
| Molecular Weight | 530.65 g/mol |
| Exact Mass | 530.21 |
| IUPAC Name | N-[6-[4-[5-[[2-[3-(1-hydroxyethyl)phenyl]acetyl]amino]-1,3,4-thiadiazol-2-yl]butyl]pyridazin-3-yl]-2-phenylacetamide |
| SMILES | CC(O)c1cccc(CC(=O)Nc2nnc(CCCCc3ccc(NC(=O)Cc4ccccc4)nn3)s2)c1 |
| InChI | InChI=1S/C28H30N6O3S/c1-19(35)22-11-7-10-21(16-22)18-26(37)30-28-34-33-27(38-28)13-6-5-12-23-14-15-24(32-31-23)29-25(36)17-20-8-3-2-4-9-20/h2-4,7-11,14-16,19,35H,5-6,12-13,17-18H2,1H3,(H,29,32,36)(H,30,34,37) |
| InChIKey | QVOWGRZNXMXZSW-UHFFFAOYSA-N |
| XLogP | 4.31 |
| TPSA | 129.99 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 530.65 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|