C27H26N6O2S — CID 118620930
(2R)-N-[5-[4-(6-benzyl-7H-pyrrolo[2,3-c]pyridazin-3-yl)butyl]-1,3,4-thiadiazol-2-yl]-2-hydroxy-2-phenylacetamide (PubChem CID 118620930) has the molecular formula C27H26N6O2S and a molecular weight of 498.61 g/mol. Its IUPAC name is (2R)-N-[5-[4-(6-benzyl-7H-pyrrolo[2,3-c]pyridazin-3-yl)butyl]-1,3,4-thiadiazol-2-yl]-2-hydroxy-2-phenylacetamide.
| Compound Name | (2R)-N-[5-[4-(6-benzyl-7H-pyrrolo[2,3-c]pyridazin-3-yl)butyl]-1,3,4-thiadiazol-2-yl]-2-hydroxy-2-phenylacetamide |
|---|---|
| PubChem CID | 118620930 |
| Molecular Formula | C27H26N6O2S |
| Molecular Weight | 498.61 g/mol |
| Exact Mass | 498.18 |
| IUPAC Name | (2R)-N-[5-[4-(6-benzyl-7H-pyrrolo[2,3-c]pyridazin-3-yl)butyl]-1,3,4-thiadiazol-2-yl]-2-hydroxy-2-phenylacetamide |
| SMILES | O=C(Nc1nnc(CCCCc2cc3cc(Cc4ccccc4)[nH]c3nn2)s1)[C@H](O)c1ccccc1 |
| InChI | InChI=1S/C27H26N6O2S/c34-24(19-11-5-2-6-12-19)26(35)29-27-33-31-23(36-27)14-8-7-13-21-16-20-17-22(28-25(20)32-30-21)15-18-9-3-1-4-10-18/h1-6,9-12,16-17,24,34H,7-8,13-15H2,(H,28,32)(H,29,33,35)/t24-/m1/s1 |
| InChIKey | QWRQZBHQQQZXMC-XMMPIXPASA-N |
| XLogP | 4.64 |
| TPSA | 116.68 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.61 |
| LogP ≤ 5 | 4.64 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|