C29H29N5OS — CID 148877738
N-[5-[5-(6-benzyl-7H-cyclopenta[c]pyridazin-3-yl)pentyl]-1,3,4-thiadiazol-2-yl]-2-phenylacetamide (PubChem CID 148877738) has the molecular formula C29H29N5OS and a molecular weight of 495.65 g/mol. Its IUPAC name is N-[5-[5-(6-benzyl-7H-cyclopenta[c]pyridazin-3-yl)pentyl]-1,3,4-thiadiazol-2-yl]-2-phenylacetamide.
| Compound Name | N-[5-[5-(6-benzyl-7H-cyclopenta[c]pyridazin-3-yl)pentyl]-1,3,4-thiadiazol-2-yl]-2-phenylacetamide |
|---|---|
| PubChem CID | 148877738 |
| Molecular Formula | C29H29N5OS |
| Molecular Weight | 495.65 g/mol |
| Exact Mass | 495.21 |
| IUPAC Name | N-[5-[5-(6-benzyl-7H-cyclopenta[c]pyridazin-3-yl)pentyl]-1,3,4-thiadiazol-2-yl]-2-phenylacetamide |
| SMILES | O=C(Cc1ccccc1)Nc1nnc(CCCCCc2cc3c(nn2)CC(Cc2ccccc2)=C3)s1 |
| InChI | InChI=1S/C29H29N5OS/c35-27(19-22-12-6-2-7-13-22)30-29-34-33-28(36-29)15-9-3-8-14-25-20-24-17-23(18-26(24)32-31-25)16-21-10-4-1-5-11-21/h1-2,4-7,10-13,17,20H,3,8-9,14-16,18-19H2,(H,30,34,35) |
| InChIKey | PCLBBCVFABDYBK-UHFFFAOYSA-N |
| XLogP | 5.65 |
| TPSA | 80.66 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 495.65 |
| LogP ≤ 5 | 5.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|