C28H29N7OS — CID 118620687
2-[3-(aminomethyl)phenyl]-N-[5-[4-(6-benzyl-7H-pyrrolo[2,3-c]pyridazin-3-yl)butyl]-1,3,4-thiadiazol-2-yl]acetamide (PubChem CID 118620687) has the molecular formula C28H29N7OS and a molecular weight of 511.66 g/mol. Its IUPAC name is 2-[3-(aminomethyl)phenyl]-N-[5-[4-(6-benzyl-7H-pyrrolo[2,3-c]pyridazin-3-yl)butyl]-1,3,4-thiadiazol-2-yl]acetamide.
| Compound Name | 2-[3-(aminomethyl)phenyl]-N-[5-[4-(6-benzyl-7H-pyrrolo[2,3-c]pyridazin-3-yl)butyl]-1,3,4-thiadiazol-2-yl]acetamide |
|---|---|
| PubChem CID | 118620687 |
| Molecular Formula | C28H29N7OS |
| Molecular Weight | 511.66 g/mol |
| Exact Mass | 511.22 |
| IUPAC Name | 2-[3-(aminomethyl)phenyl]-N-[5-[4-(6-benzyl-7H-pyrrolo[2,3-c]pyridazin-3-yl)butyl]-1,3,4-thiadiazol-2-yl]acetamide |
| SMILES | NCc1cccc(CC(=O)Nc2nnc(CCCCc3cc4cc(Cc5ccccc5)[nH]c4nn3)s2)c1 |
| InChI | InChI=1S/C28H29N7OS/c29-18-21-10-6-9-20(13-21)15-25(36)31-28-35-33-26(37-28)12-5-4-11-23-16-22-17-24(30-27(22)34-32-23)14-19-7-2-1-3-8-19/h1-3,6-10,13,16-17H,4-5,11-12,14-15,18,29H2,(H,30,34)(H,31,35,36) |
| InChIKey | AAWBYBAXENPNIZ-UHFFFAOYSA-N |
| XLogP | 4.61 |
| TPSA | 122.47 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 511.66 |
| LogP ≤ 5 | 4.61 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|