C21H25N5OS — CID 134402941
2-(3-ethylphenyl)-N-[5-[4-(6-methylpyridazin-3-yl)butyl]-1,3,4-thiadiazol-2-yl]acetamide (PubChem CID 134402941) has the molecular formula C21H25N5OS and a molecular weight of 395.53 g/mol. Its IUPAC name is 2-(3-ethylphenyl)-N-[5-[4-(6-methylpyridazin-3-yl)butyl]-1,3,4-thiadiazol-2-yl]acetamide.
| Compound Name | 2-(3-ethylphenyl)-N-[5-[4-(6-methylpyridazin-3-yl)butyl]-1,3,4-thiadiazol-2-yl]acetamide |
|---|---|
| PubChem CID | 134402941 |
| Molecular Formula | C21H25N5OS |
| Molecular Weight | 395.53 g/mol |
| Exact Mass | 395.18 |
| IUPAC Name | 2-(3-ethylphenyl)-N-[5-[4-(6-methylpyridazin-3-yl)butyl]-1,3,4-thiadiazol-2-yl]acetamide |
| SMILES | CCc1cccc(CC(=O)Nc2nnc(CCCCc3ccc(C)nn3)s2)c1 |
| InChI | InChI=1S/C21H25N5OS/c1-3-16-7-6-8-17(13-16)14-19(27)22-21-26-25-20(28-21)10-5-4-9-18-12-11-15(2)23-24-18/h6-8,11-13H,3-5,9-10,14H2,1-2H3,(H,22,26,27) |
| InChIKey | PYYNMQFXQPDOCJ-UHFFFAOYSA-N |
| XLogP | 3.95 |
| TPSA | 80.66 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.53 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|