C28H34N6O2S — CID 145168258
N-[(1E,3Z)-1,4-diamino-8-[5-[[2-(3-ethylphenyl)acetyl]amino]-1,3,4-thiadiazol-2-yl]octa-1,3-dienyl]-2-phenylacetamide (PubChem CID 145168258) has the molecular formula C28H34N6O2S and a molecular weight of 518.69 g/mol. Its IUPAC name is N-[(1E,3Z)-1,4-diamino-8-[5-[[2-(3-ethylphenyl)acetyl]amino]-1,3,4-thiadiazol-2-yl]octa-1,3-dienyl]-2-phenylacetamide.
| Compound Name | N-[(1E,3Z)-1,4-diamino-8-[5-[[2-(3-ethylphenyl)acetyl]amino]-1,3,4-thiadiazol-2-yl]octa-1,3-dienyl]-2-phenylacetamide |
|---|---|
| PubChem CID | 145168258 |
| Molecular Formula | C28H34N6O2S |
| Molecular Weight | 518.69 g/mol |
| Exact Mass | 518.25 |
| IUPAC Name | N-[(1E,3Z)-1,4-diamino-8-[5-[[2-(3-ethylphenyl)acetyl]amino]-1,3,4-thiadiazol-2-yl]octa-1,3-dienyl]-2-phenylacetamide |
| SMILES | CCc1cccc(CC(=O)Nc2nnc(CCCC/C(N)=C/C=C(\N)NC(=O)Cc3ccccc3)s2)c1 |
| InChI | InChI=1S/C28H34N6O2S/c1-2-20-11-8-12-22(17-20)19-26(36)32-28-34-33-27(37-28)14-7-6-13-23(29)15-16-24(30)31-25(35)18-21-9-4-3-5-10-21/h3-5,8-12,15-17H,2,6-7,13-14,18-19,29-30H2,1H3,(H,31,35)(H,32,34,36)/b23-15-,24-16+ |
| InChIKey | JJIBNNTZWUVNNO-REPVBDINSA-N |
| XLogP | 4.00 |
| TPSA | 136.02 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 518.69 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|