C26H37N7O3S — CID 144921996
N-[[3-[2-[[5-[(5Z,7E)-8-acetamido-5,8-diaminoocta-5,7-dienyl]-1,3,4-thiadiazol-2-yl]amino]-2-oxoethyl]phenyl]methyl]-3-methylbutanamide (PubChem CID 144921996) has the molecular formula C26H37N7O3S and a molecular weight of 527.70 g/mol. Its IUPAC name is N-[[3-[2-[[5-[(5Z,7E)-8-acetamido-5,8-diaminoocta-5,7-dienyl]-1,3,4-thiadiazol-2-yl]amino]-2-oxoethyl]phenyl]methyl]-3-methylbutanamide.
| Compound Name | N-[[3-[2-[[5-[(5Z,7E)-8-acetamido-5,8-diaminoocta-5,7-dienyl]-1,3,4-thiadiazol-2-yl]amino]-2-oxoethyl]phenyl]methyl]-3-methylbutanamide |
|---|---|
| PubChem CID | 144921996 |
| Molecular Formula | C26H37N7O3S |
| Molecular Weight | 527.70 g/mol |
| Exact Mass | 527.27 |
| IUPAC Name | N-[[3-[2-[[5-[(5Z,7E)-8-acetamido-5,8-diaminoocta-5,7-dienyl]-1,3,4-thiadiazol-2-yl]amino]-2-oxoethyl]phenyl]methyl]-3-methylbutanamide |
| SMILES | CC(=O)N/C(N)=C/C=C(\N)CCCCc1nnc(NC(=O)Cc2cccc(CNC(=O)CC(C)C)c2)s1 |
| InChI | InChI=1S/C26H37N7O3S/c1-17(2)13-23(35)29-16-20-8-6-7-19(14-20)15-24(36)31-26-33-32-25(37-26)10-5-4-9-21(27)11-12-22(28)30-18(3)34/h6-8,11-12,14,17H,4-5,9-10,13,15-16,27-28H2,1-3H3,(H,29,35)(H,30,34)(H,31,33,36)/b21-11-,22-12+ |
| InChIKey | SNZUVFYPWGXBIH-ZCJKAFFOSA-N |
| XLogP | 2.87 |
| TPSA | 165.12 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 527.70 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|