C31H41N7O3S — CID 145164741
(3E,5Z)-N-[(1E,3Z)-1,4-diamino-8-[5-[[2-[3-[2-(azetidin-1-yl)-2-oxoethyl]phenyl]acetyl]amino]-1,3,4-thiadiazol-2-yl]octa-1,3-dienyl]-3-methylhepta-3,5-dienamide (PubChem CID 145164741) has the molecular formula C31H41N7O3S and a molecular weight of 591.78 g/mol. Its IUPAC name is (3E,5Z)-N-[(1E,3Z)-1,4-diamino-8-[5-[[2-[3-[2-(azetidin-1-yl)-2-oxoethyl]phenyl]acetyl]amino]-1,3,4-thiadiazol-2-yl]octa-1,3-dienyl]-3-methylhepta-3,5-dienamide.
| Compound Name | (3E,5Z)-N-[(1E,3Z)-1,4-diamino-8-[5-[[2-[3-[2-(azetidin-1-yl)-2-oxoethyl]phenyl]acetyl]amino]-1,3,4-thiadiazol-2-yl]octa-1,3-dienyl]-3-methylhepta-3,5-dienamide |
|---|---|
| PubChem CID | 145164741 |
| Molecular Formula | C31H41N7O3S |
| Molecular Weight | 591.78 g/mol |
| Exact Mass | 591.30 |
| IUPAC Name | (3E,5Z)-N-[(1E,3Z)-1,4-diamino-8-[5-[[2-[3-[2-(azetidin-1-yl)-2-oxoethyl]phenyl]acetyl]amino]-1,3,4-thiadiazol-2-yl]octa-1,3-dienyl]-3-methylhepta-3,5-dienamide |
| SMILES | C/C=C\C=C(/C)CC(=O)N/C(N)=C/C=C(\N)CCCCc1nnc(NC(=O)Cc2cccc(CC(=O)N3CCC3)c2)s1 |
| InChI | InChI=1S/C31H41N7O3S/c1-3-4-9-22(2)18-27(39)34-26(33)15-14-25(32)12-5-6-13-29-36-37-31(42-29)35-28(40)20-23-10-7-11-24(19-23)21-30(41)38-16-8-17-38/h3-4,7,9-11,14-15,19H,5-6,8,12-13,16-18,20-21,32-33H2,1-2H3,(H,34,39)(H,35,37,40)/b4-3-,22-9+,25-14-,26-15+ |
| InChIKey | LMFDOMKUMAZERY-BEKRQHPWSA-N |
| XLogP | 3.88 |
| TPSA | 156.33 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 591.78 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|