C26H39N7O3S — CID 144641174
tert-butyl N-[2-[3-[2-[[5-[(5Z,7E)-5,8-diamino-8-(methylamino)octa-5,7-dienyl]-1,3,4-thiadiazol-2-yl]amino]-2-oxoethyl]phenyl]ethyl]carbamate (PubChem CID 144641174) has the molecular formula C26H39N7O3S and a molecular weight of 529.71 g/mol. Its IUPAC name is tert-butyl N-[2-[3-[2-[[5-[(5Z,7E)-5,8-diamino-8-(methylamino)octa-5,7-dienyl]-1,3,4-thiadiazol-2-yl]amino]-2-oxoethyl]phenyl]ethyl]carbamate.
| Compound Name | tert-butyl N-[2-[3-[2-[[5-[(5Z,7E)-5,8-diamino-8-(methylamino)octa-5,7-dienyl]-1,3,4-thiadiazol-2-yl]amino]-2-oxoethyl]phenyl]ethyl]carbamate |
|---|---|
| PubChem CID | 144641174 |
| Molecular Formula | C26H39N7O3S |
| Molecular Weight | 529.71 g/mol |
| Exact Mass | 529.28 |
| IUPAC Name | tert-butyl N-[2-[3-[2-[[5-[(5Z,7E)-5,8-diamino-8-(methylamino)octa-5,7-dienyl]-1,3,4-thiadiazol-2-yl]amino]-2-oxoethyl]phenyl]ethyl]carbamate |
| SMILES | CN/C(N)=C/C=C(\N)CCCCc1nnc(NC(=O)Cc2cccc(CCNC(=O)OC(C)(C)C)c2)s1 |
| InChI | InChI=1S/C26H39N7O3S/c1-26(2,3)36-25(35)30-15-14-18-8-7-9-19(16-18)17-22(34)31-24-33-32-23(37-24)11-6-5-10-20(27)12-13-21(28)29-4/h7-9,12-13,16,29H,5-6,10-11,14-15,17,27-28H2,1-4H3,(H,30,35)(H,31,33,34)/b20-12-,21-13+ |
| InChIKey | UOFOLMSKPLALFZ-AYRZQKSOSA-N |
| XLogP | 3.36 |
| TPSA | 157.28 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 529.71 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|