C30H40N6O3S — CID 139499592
2-cyclohexa-1,5-dien-1-yl-N-[(1E,3Z)-1,4-diamino-8-[5-[[2-[3-(2-hydroxy-2-methylpropyl)phenyl]acetyl]amino]-1,3,4-thiadiazol-2-yl]octa-1,3-dienyl]acetamide (PubChem CID 139499592) has the molecular formula C30H40N6O3S and a molecular weight of 564.76 g/mol. Its IUPAC name is 2-cyclohexa-1,5-dien-1-yl-N-[(1E,3Z)-1,4-diamino-8-[5-[[2-[3-(2-hydroxy-2-methylpropyl)phenyl]acetyl]amino]-1,3,4-thiadiazol-2-yl]octa-1,3-dienyl]acetamide.
| Compound Name | 2-cyclohexa-1,5-dien-1-yl-N-[(1E,3Z)-1,4-diamino-8-[5-[[2-[3-(2-hydroxy-2-methylpropyl)phenyl]acetyl]amino]-1,3,4-thiadiazol-2-yl]octa-1,3-dienyl]acetamide |
|---|---|
| PubChem CID | 139499592 |
| Molecular Formula | C30H40N6O3S |
| Molecular Weight | 564.76 g/mol |
| Exact Mass | 564.29 |
| IUPAC Name | 2-cyclohexa-1,5-dien-1-yl-N-[(1E,3Z)-1,4-diamino-8-[5-[[2-[3-(2-hydroxy-2-methylpropyl)phenyl]acetyl]amino]-1,3,4-thiadiazol-2-yl]octa-1,3-dienyl]acetamide |
| SMILES | CC(C)(O)Cc1cccc(CC(=O)Nc2nnc(CCCC/C(N)=C/C=C(\N)NC(=O)CC3=CCCC=C3)s2)c1 |
| InChI | InChI=1S/C30H40N6O3S/c1-30(2,39)20-23-12-8-11-22(17-23)19-27(38)34-29-36-35-28(40-29)14-7-6-13-24(31)15-16-25(32)33-26(37)18-21-9-4-3-5-10-21/h4,8-12,15-17,39H,3,5-7,13-14,18-20,31-32H2,1-2H3,(H,33,37)(H,34,36,38)/b24-15-,25-16+ |
| InChIKey | MUHNVYZDUORKLD-QTCLYGBFSA-N |
| XLogP | 4.17 |
| TPSA | 156.25 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 564.76 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|