C31H40N6O4S2 — CID 74982818
N-[(1E,3Z)-1,4-diamino-8-[5-[[2-[3-(butylsulfonylmethyl)phenyl]acetyl]amino]-1,3,4-thiadiazol-2-yl]octa-1,3-dienyl]-2-phenylacetamide (PubChem CID 74982818) has the molecular formula C31H40N6O4S2 and a molecular weight of 624.83 g/mol. Its IUPAC name is N-[(1E,3Z)-1,4-diamino-8-[5-[[2-[3-(butylsulfonylmethyl)phenyl]acetyl]amino]-1,3,4-thiadiazol-2-yl]octa-1,3-dienyl]-2-phenylacetamide.
| Compound Name | N-[(1E,3Z)-1,4-diamino-8-[5-[[2-[3-(butylsulfonylmethyl)phenyl]acetyl]amino]-1,3,4-thiadiazol-2-yl]octa-1,3-dienyl]-2-phenylacetamide |
|---|---|
| PubChem CID | 74982818 |
| Molecular Formula | C31H40N6O4S2 |
| Molecular Weight | 624.83 g/mol |
| Exact Mass | 624.26 |
| IUPAC Name | N-[(1E,3Z)-1,4-diamino-8-[5-[[2-[3-(butylsulfonylmethyl)phenyl]acetyl]amino]-1,3,4-thiadiazol-2-yl]octa-1,3-dienyl]-2-phenylacetamide |
| SMILES | CCCCS(=O)(=O)Cc1cccc(CC(=O)Nc2nnc(CCCC/C(N)=C/C=C(\N)NC(=O)Cc3ccccc3)s2)c1 |
| InChI | InChI=1S/C31H40N6O4S2/c1-2-3-18-43(40,41)22-25-13-9-12-24(19-25)21-29(39)35-31-37-36-30(42-31)15-8-7-14-26(32)16-17-27(33)34-28(38)20-23-10-5-4-6-11-23/h4-6,9-13,16-17,19H,2-3,7-8,14-15,18,20-22,32-33H2,1H3,(H,34,38)(H,35,37,39)/b26-16-,27-17+ |
| InChIKey | UJRVPRWNUBBSMD-WVZLMVLXSA-N |
| XLogP | 4.15 |
| TPSA | 170.16 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 43 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 624.83 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|