C27H28ClF3N6O2S — CID 144641034
N-[5-[(5Z,7E)-5,8-diamino-8-[[2-(3-chlorophenyl)acetyl]amino]octa-5,7-dienyl]-1,3,4-thiadiazol-2-yl]-2-[3-(trifluoromethyl)phenyl]acetamide (PubChem CID 144641034) has the molecular formula C27H28ClF3N6O2S and a molecular weight of 593.08 g/mol. Its IUPAC name is N-[5-[(5Z,7E)-5,8-diamino-8-[[2-(3-chlorophenyl)acetyl]amino]octa-5,7-dienyl]-1,3,4-thiadiazol-2-yl]-2-[3-(trifluoromethyl)phenyl]acetamide.
| Compound Name | N-[5-[(5Z,7E)-5,8-diamino-8-[[2-(3-chlorophenyl)acetyl]amino]octa-5,7-dienyl]-1,3,4-thiadiazol-2-yl]-2-[3-(trifluoromethyl)phenyl]acetamide |
|---|---|
| PubChem CID | 144641034 |
| Molecular Formula | C27H28ClF3N6O2S |
| Molecular Weight | 593.08 g/mol |
| Exact Mass | 592.16 |
| IUPAC Name | N-[5-[(5Z,7E)-5,8-diamino-8-[[2-(3-chlorophenyl)acetyl]amino]octa-5,7-dienyl]-1,3,4-thiadiazol-2-yl]-2-[3-(trifluoromethyl)phenyl]acetamide |
| SMILES | N/C(=C\C=C(/N)NC(=O)Cc1cccc(Cl)c1)CCCCc1nnc(NC(=O)Cc2cccc(C(F)(F)F)c2)s1 |
| InChI | InChI=1S/C27H28ClF3N6O2S/c28-20-8-4-6-18(14-20)16-23(38)34-22(33)12-11-21(32)9-1-2-10-25-36-37-26(40-25)35-24(39)15-17-5-3-7-19(13-17)27(29,30)31/h3-8,11-14H,1-2,9-10,15-16,32-33H2,(H,34,38)(H,35,37,39)/b21-11-,22-12+ |
| InChIKey | UFGAFOWMYLPAMG-ZCJKAFFOSA-N |
| XLogP | 5.11 |
| TPSA | 136.02 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 593.08 |
| LogP ≤ 5 | 5.11 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|