C24H27F3N8O3S — CID 144629998
N-[(1E,3Z)-1,4-diamino-8-[5-[(2-pyrazol-1-ylacetyl)amino]-1,3,4-thiadiazol-2-yl]octa-1,3-dienyl]-2-[3-(trifluoromethoxy)phenyl]acetamide (PubChem CID 144629998) has the molecular formula C24H27F3N8O3S and a molecular weight of 564.59 g/mol. Its IUPAC name is N-[(1E,3Z)-1,4-diamino-8-[5-[(2-pyrazol-1-ylacetyl)amino]-1,3,4-thiadiazol-2-yl]octa-1,3-dienyl]-2-[3-(trifluoromethoxy)phenyl]acetamide.
| Compound Name | N-[(1E,3Z)-1,4-diamino-8-[5-[(2-pyrazol-1-ylacetyl)amino]-1,3,4-thiadiazol-2-yl]octa-1,3-dienyl]-2-[3-(trifluoromethoxy)phenyl]acetamide |
|---|---|
| PubChem CID | 144629998 |
| Molecular Formula | C24H27F3N8O3S |
| Molecular Weight | 564.59 g/mol |
| Exact Mass | 564.19 |
| IUPAC Name | N-[(1E,3Z)-1,4-diamino-8-[5-[(2-pyrazol-1-ylacetyl)amino]-1,3,4-thiadiazol-2-yl]octa-1,3-dienyl]-2-[3-(trifluoromethoxy)phenyl]acetamide |
| SMILES | N/C(=C\C=C(/N)NC(=O)Cc1cccc(OC(F)(F)F)c1)CCCCc1nnc(NC(=O)Cn2cccn2)s1 |
| InChI | InChI=1S/C24H27F3N8O3S/c25-24(26,27)38-18-7-3-5-16(13-18)14-20(36)31-19(29)10-9-17(28)6-1-2-8-22-33-34-23(39-22)32-21(37)15-35-12-4-11-30-35/h3-5,7,9-13H,1-2,6,8,14-15,28-29H2,(H,31,36)(H,32,34,37)/b17-9-,19-10+ |
| InChIKey | WWPFENHEBWURIJ-QUBPRYNHSA-N |
| XLogP | 2.99 |
| TPSA | 163.07 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 564.59 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|