C29H34F3N7O4S — CID 166972042
N-[5-[(5Z,7E)-5,8-diamino-8-[[2-[3-(trifluoromethoxy)phenyl]acetyl]amino]octa-5,7-dienyl]-1,3,4-thiadiazol-2-yl]-4-methoxy-2-pyridin-3-ylbutanamide (PubChem CID 166972042) has the molecular formula C29H34F3N7O4S and a molecular weight of 633.70 g/mol. Its IUPAC name is N-[5-[(5Z,7E)-5,8-diamino-8-[[2-[3-(trifluoromethoxy)phenyl]acetyl]amino]octa-5,7-dienyl]-1,3,4-thiadiazol-2-yl]-4-methoxy-2-pyridin-3-ylbutanamide.
| Compound Name | N-[5-[(5Z,7E)-5,8-diamino-8-[[2-[3-(trifluoromethoxy)phenyl]acetyl]amino]octa-5,7-dienyl]-1,3,4-thiadiazol-2-yl]-4-methoxy-2-pyridin-3-ylbutanamide |
|---|---|
| PubChem CID | 166972042 |
| Molecular Formula | C29H34F3N7O4S |
| Molecular Weight | 633.70 g/mol |
| Exact Mass | 633.23 |
| IUPAC Name | N-[5-[(5Z,7E)-5,8-diamino-8-[[2-[3-(trifluoromethoxy)phenyl]acetyl]amino]octa-5,7-dienyl]-1,3,4-thiadiazol-2-yl]-4-methoxy-2-pyridin-3-ylbutanamide |
| SMILES | COCCC(C(=O)Nc1nnc(CCCC/C(N)=C/C=C(\N)NC(=O)Cc2cccc(OC(F)(F)F)c2)s1)c1cccnc1 |
| InChI | InChI=1S/C29H34F3N7O4S/c1-42-15-13-23(20-7-5-14-35-18-20)27(41)37-28-39-38-26(44-28)10-3-2-8-21(33)11-12-24(34)36-25(40)17-19-6-4-9-22(16-19)43-29(30,31)32/h4-7,9,11-12,14,16,18,23H,2-3,8,10,13,15,17,33-34H2,1H3,(H,36,40)(H,37,39,41)/b21-11-,24-12+ |
| InChIKey | SFZILMHJZJVZJI-DNVDEYQTSA-N |
| XLogP | 4.30 |
| TPSA | 167.37 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 44 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 633.70 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|