C17H20F3N3O3S — CID 139460953
N-[5-(6-hydroxyhexyl)-1,3,4-thiadiazol-2-yl]-2-[3-(trifluoromethoxy)phenyl]acetamide (PubChem CID 139460953) has the molecular formula C17H20F3N3O3S and a molecular weight of 403.43 g/mol. Its IUPAC name is N-[5-(6-hydroxyhexyl)-1,3,4-thiadiazol-2-yl]-2-[3-(trifluoromethoxy)phenyl]acetamide.
| Compound Name | N-[5-(6-hydroxyhexyl)-1,3,4-thiadiazol-2-yl]-2-[3-(trifluoromethoxy)phenyl]acetamide |
|---|---|
| PubChem CID | 139460953 |
| Molecular Formula | C17H20F3N3O3S |
| Molecular Weight | 403.43 g/mol |
| Exact Mass | 403.12 |
| IUPAC Name | N-[5-(6-hydroxyhexyl)-1,3,4-thiadiazol-2-yl]-2-[3-(trifluoromethoxy)phenyl]acetamide |
| SMILES | O=C(Cc1cccc(OC(F)(F)F)c1)Nc1nnc(CCCCCCO)s1 |
| InChI | InChI=1S/C17H20F3N3O3S/c18-17(19,20)26-13-7-5-6-12(10-13)11-14(25)21-16-23-22-15(27-16)8-3-1-2-4-9-24/h5-7,10,24H,1-4,8-9,11H2,(H,21,23,25) |
| InChIKey | RJRTXDDROPOGLU-UHFFFAOYSA-N |
| XLogP | 3.71 |
| TPSA | 84.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.43 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|