C29H30F6N6O4S — CID 139499369
N-[5-[(5Z,7E)-5,8-diamino-8-[[2-[3-(trifluoromethoxy)phenyl]acetyl]amino]octa-5,7-dienyl]-1,3,4-thiadiazol-2-yl]-2-[3-(2,2,2-trifluoroethoxy)phenyl]acetamide (PubChem CID 139499369) has the molecular formula C29H30F6N6O4S and a molecular weight of 672.65 g/mol. Its IUPAC name is N-[5-[(5Z,7E)-5,8-diamino-8-[[2-[3-(trifluoromethoxy)phenyl]acetyl]amino]octa-5,7-dienyl]-1,3,4-thiadiazol-2-yl]-2-[3-(2,2,2-trifluoroethoxy)phenyl]acetamide.
| Compound Name | N-[5-[(5Z,7E)-5,8-diamino-8-[[2-[3-(trifluoromethoxy)phenyl]acetyl]amino]octa-5,7-dienyl]-1,3,4-thiadiazol-2-yl]-2-[3-(2,2,2-trifluoroethoxy)phenyl]acetamide |
|---|---|
| PubChem CID | 139499369 |
| Molecular Formula | C29H30F6N6O4S |
| Molecular Weight | 672.65 g/mol |
| Exact Mass | 672.20 |
| IUPAC Name | N-[5-[(5Z,7E)-5,8-diamino-8-[[2-[3-(trifluoromethoxy)phenyl]acetyl]amino]octa-5,7-dienyl]-1,3,4-thiadiazol-2-yl]-2-[3-(2,2,2-trifluoroethoxy)phenyl]acetamide |
| SMILES | N/C(=C\C=C(/N)NC(=O)Cc1cccc(OC(F)(F)F)c1)CCCCc1nnc(NC(=O)Cc2cccc(OCC(F)(F)F)c2)s1 |
| InChI | InChI=1S/C29H30F6N6O4S/c30-28(31,32)17-44-21-8-3-5-18(13-21)16-25(43)39-27-41-40-26(46-27)10-2-1-7-20(36)11-12-23(37)38-24(42)15-19-6-4-9-22(14-19)45-29(33,34)35/h3-6,8-9,11-14H,1-2,7,10,15-17,36-37H2,(H,38,42)(H,39,41,43)/b20-11-,23-12+ |
| InChIKey | XSPDETXLGWOHEU-WIYREJOOSA-N |
| XLogP | 5.27 |
| TPSA | 154.48 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 672.65 |
| LogP ≤ 5 | 5.27 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|