C26H29F4N7O3S — CID 166971957
N-[5-[(5Z,7E)-5,8-diamino-8-[[2-[2-fluoro-5-(trifluoromethoxy)phenyl]acetyl]amino]octa-5,7-dienyl]-1,3,4-thiadiazol-2-yl]-2-(3,4-dihydropyridin-2-yl)acetamide (PubChem CID 166971957) has the molecular formula C26H29F4N7O3S and a molecular weight of 595.62 g/mol. Its IUPAC name is N-[5-[(5Z,7E)-5,8-diamino-8-[[2-[2-fluoro-5-(trifluoromethoxy)phenyl]acetyl]amino]octa-5,7-dienyl]-1,3,4-thiadiazol-2-yl]-2-(3,4-dihydropyridin-2-yl)acetamide.
| Compound Name | N-[5-[(5Z,7E)-5,8-diamino-8-[[2-[2-fluoro-5-(trifluoromethoxy)phenyl]acetyl]amino]octa-5,7-dienyl]-1,3,4-thiadiazol-2-yl]-2-(3,4-dihydropyridin-2-yl)acetamide |
|---|---|
| PubChem CID | 166971957 |
| Molecular Formula | C26H29F4N7O3S |
| Molecular Weight | 595.62 g/mol |
| Exact Mass | 595.20 |
| IUPAC Name | N-[5-[(5Z,7E)-5,8-diamino-8-[[2-[2-fluoro-5-(trifluoromethoxy)phenyl]acetyl]amino]octa-5,7-dienyl]-1,3,4-thiadiazol-2-yl]-2-(3,4-dihydropyridin-2-yl)acetamide |
| SMILES | N/C(=C\C=C(/N)NC(=O)Cc1cc(OC(F)(F)F)ccc1F)CCCCc1nnc(NC(=O)CC2=NC=CCC2)s1 |
| InChI | InChI=1S/C26H29F4N7O3S/c27-20-10-9-19(40-26(28,29)30)13-16(20)14-22(38)34-21(32)11-8-17(31)5-1-2-7-24-36-37-25(41-24)35-23(39)15-18-6-3-4-12-33-18/h4,8-13H,1-3,5-7,14-15,31-32H2,(H,34,38)(H,35,37,39)/b17-8-,21-11+ |
| InChIKey | GRMMLFPBUBHIKT-HKISXBFXSA-N |
| XLogP | 4.37 |
| TPSA | 157.61 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 595.62 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|