C27H29F3N6O3S — CID 145168262
N-[5-[(5Z,7E)-5,8-diamino-8-[[2-[2-(trifluoromethoxy)phenyl]acetyl]amino]octa-5,7-dienyl]-1,3,4-thiadiazol-2-yl]-2-phenylacetamide (PubChem CID 145168262) has the molecular formula C27H29F3N6O3S and a molecular weight of 574.63 g/mol. Its IUPAC name is N-[5-[(5Z,7E)-5,8-diamino-8-[[2-[2-(trifluoromethoxy)phenyl]acetyl]amino]octa-5,7-dienyl]-1,3,4-thiadiazol-2-yl]-2-phenylacetamide.
| Compound Name | N-[5-[(5Z,7E)-5,8-diamino-8-[[2-[2-(trifluoromethoxy)phenyl]acetyl]amino]octa-5,7-dienyl]-1,3,4-thiadiazol-2-yl]-2-phenylacetamide |
|---|---|
| PubChem CID | 145168262 |
| Molecular Formula | C27H29F3N6O3S |
| Molecular Weight | 574.63 g/mol |
| Exact Mass | 574.20 |
| IUPAC Name | N-[5-[(5Z,7E)-5,8-diamino-8-[[2-[2-(trifluoromethoxy)phenyl]acetyl]amino]octa-5,7-dienyl]-1,3,4-thiadiazol-2-yl]-2-phenylacetamide |
| SMILES | N/C(=C\C=C(/N)NC(=O)Cc1ccccc1OC(F)(F)F)CCCCc1nnc(NC(=O)Cc2ccccc2)s1 |
| InChI | InChI=1S/C27H29F3N6O3S/c28-27(29,30)39-21-12-6-4-10-19(21)17-24(38)33-22(32)15-14-20(31)11-5-7-13-25-35-36-26(40-25)34-23(37)16-18-8-2-1-3-9-18/h1-4,6,8-10,12,14-15H,5,7,11,13,16-17,31-32H2,(H,33,38)(H,34,36,37)/b20-14-,22-15+ |
| InChIKey | VSGFUKRMBVPTAC-UAKSEAGPSA-N |
| XLogP | 4.33 |
| TPSA | 145.25 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 574.63 |
| LogP ≤ 5 | 4.33 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|