C28H30F3N7O3S — CID 166654361
2-(5-cyanocyclohexa-1,3-dien-1-yl)-N-[5-[(5Z,7E)-5,8-diamino-8-[[2-[3-(trifluoromethoxy)phenyl]acetyl]amino]octa-5,7-dienyl]-1,3,4-thiadiazol-2-yl]acetamide (PubChem CID 166654361) has the molecular formula C28H30F3N7O3S and a molecular weight of 601.66 g/mol. Its IUPAC name is 2-(5-cyanocyclohexa-1,3-dien-1-yl)-N-[5-[(5Z,7E)-5,8-diamino-8-[[2-[3-(trifluoromethoxy)phenyl]acetyl]amino]octa-5,7-dienyl]-1,3,4-thiadiazol-2-yl]acetamide.
| Compound Name | 2-(5-cyanocyclohexa-1,3-dien-1-yl)-N-[5-[(5Z,7E)-5,8-diamino-8-[[2-[3-(trifluoromethoxy)phenyl]acetyl]amino]octa-5,7-dienyl]-1,3,4-thiadiazol-2-yl]acetamide |
|---|---|
| PubChem CID | 166654361 |
| Molecular Formula | C28H30F3N7O3S |
| Molecular Weight | 601.66 g/mol |
| Exact Mass | 601.21 |
| IUPAC Name | 2-(5-cyanocyclohexa-1,3-dien-1-yl)-N-[5-[(5Z,7E)-5,8-diamino-8-[[2-[3-(trifluoromethoxy)phenyl]acetyl]amino]octa-5,7-dienyl]-1,3,4-thiadiazol-2-yl]acetamide |
| SMILES | N#CC1C=CC=C(CC(=O)Nc2nnc(CCCC/C(N)=C/C=C(\N)NC(=O)Cc3cccc(OC(F)(F)F)c3)s2)C1 |
| InChI | InChI=1S/C28H30F3N7O3S/c29-28(30,31)41-22-9-4-6-19(14-22)16-24(39)35-23(34)12-11-21(33)8-1-2-10-26-37-38-27(42-26)36-25(40)15-18-5-3-7-20(13-18)17-32/h3-7,9,11-12,14,20H,1-2,8,10,13,15-16,33-34H2,(H,35,39)(H,36,38,40)/b21-11-,23-12+ |
| InChIKey | ZDWSEAFDKQZFHH-LRIFWWGWSA-N |
| XLogP | 4.51 |
| TPSA | 169.04 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 601.66 |
| LogP ≤ 5 | 4.51 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|