C20H26F2N6O2S — CID 139499368
N-[5-[(5Z,7E)-5,8-diamino-8-(methylamino)octa-5,7-dienyl]-1,3,4-thiadiazol-2-yl]-2-[3-(difluoromethoxy)phenyl]acetamide (PubChem CID 139499368) has the molecular formula C20H26F2N6O2S and a molecular weight of 452.53 g/mol. Its IUPAC name is N-[5-[(5Z,7E)-5,8-diamino-8-(methylamino)octa-5,7-dienyl]-1,3,4-thiadiazol-2-yl]-2-[3-(difluoromethoxy)phenyl]acetamide.
| Compound Name | N-[5-[(5Z,7E)-5,8-diamino-8-(methylamino)octa-5,7-dienyl]-1,3,4-thiadiazol-2-yl]-2-[3-(difluoromethoxy)phenyl]acetamide |
|---|---|
| PubChem CID | 139499368 |
| Molecular Formula | C20H26F2N6O2S |
| Molecular Weight | 452.53 g/mol |
| Exact Mass | 452.18 |
| IUPAC Name | N-[5-[(5Z,7E)-5,8-diamino-8-(methylamino)octa-5,7-dienyl]-1,3,4-thiadiazol-2-yl]-2-[3-(difluoromethoxy)phenyl]acetamide |
| SMILES | CN/C(N)=C/C=C(\N)CCCCc1nnc(NC(=O)Cc2cccc(OC(F)F)c2)s1 |
| InChI | InChI=1S/C20H26F2N6O2S/c1-25-16(24)10-9-14(23)6-2-3-8-18-27-28-20(31-18)26-17(29)12-13-5-4-7-15(11-13)30-19(21)22/h4-5,7,9-11,19,25H,2-3,6,8,12,23-24H2,1H3,(H,26,28,29)/b14-9-,16-10+ |
| InChIKey | XEQUBHIAECHDJO-IDMWQADZSA-N |
| XLogP | 2.90 |
| TPSA | 128.18 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.53 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|