C29H38N6O4S — CID 139499476
N-[5-[(5Z,7E)-5,8-diamino-8-[(1-hydroxy-2-phenylethyl)amino]octa-5,7-dienyl]-1,3,4-thiadiazol-2-yl]-2-[3-(3-hydroxypropoxy)phenyl]acetamide (PubChem CID 139499476) has the molecular formula C29H38N6O4S and a molecular weight of 566.73 g/mol. Its IUPAC name is N-[5-[(5Z,7E)-5,8-diamino-8-[(1-hydroxy-2-phenylethyl)amino]octa-5,7-dienyl]-1,3,4-thiadiazol-2-yl]-2-[3-(3-hydroxypropoxy)phenyl]acetamide.
| Compound Name | N-[5-[(5Z,7E)-5,8-diamino-8-[(1-hydroxy-2-phenylethyl)amino]octa-5,7-dienyl]-1,3,4-thiadiazol-2-yl]-2-[3-(3-hydroxypropoxy)phenyl]acetamide |
|---|---|
| PubChem CID | 139499476 |
| Molecular Formula | C29H38N6O4S |
| Molecular Weight | 566.73 g/mol |
| Exact Mass | 566.27 |
| IUPAC Name | N-[5-[(5Z,7E)-5,8-diamino-8-[(1-hydroxy-2-phenylethyl)amino]octa-5,7-dienyl]-1,3,4-thiadiazol-2-yl]-2-[3-(3-hydroxypropoxy)phenyl]acetamide |
| SMILES | N/C(=C\C=C(/N)NC(O)Cc1ccccc1)CCCCc1nnc(NC(=O)Cc2cccc(OCCCO)c2)s1 |
| InChI | InChI=1S/C29H38N6O4S/c30-23(14-15-25(31)32-26(37)19-21-8-2-1-3-9-21)11-4-5-13-28-34-35-29(40-28)33-27(38)20-22-10-6-12-24(18-22)39-17-7-16-36/h1-3,6,8-10,12,14-15,18,26,32,36-37H,4-5,7,11,13,16-17,19-20,30-31H2,(H,33,35,38)/b23-14-,25-15+ |
| InChIKey | HUQKKPASBAWGAC-XMIQUKNQSA-N |
| XLogP | 2.99 |
| TPSA | 168.64 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 566.73 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|