C34H47N7O3S — CID 145168327
N-[1-[3-[2-[[(1E,3Z)-1,4-diamino-8-[5-[(2-phenylacetyl)amino]-1,3,4-thiadiazol-2-yl]octa-1,3-dienyl]amino]-2-methoxyethyl]phenyl]ethyl]-3-methylbutanamide (PubChem CID 145168327) has the molecular formula C34H47N7O3S and a molecular weight of 633.86 g/mol. Its IUPAC name is N-[1-[3-[2-[[(1E,3Z)-1,4-diamino-8-[5-[(2-phenylacetyl)amino]-1,3,4-thiadiazol-2-yl]octa-1,3-dienyl]amino]-2-methoxyethyl]phenyl]ethyl]-3-methylbutanamide.
| Compound Name | N-[1-[3-[2-[[(1E,3Z)-1,4-diamino-8-[5-[(2-phenylacetyl)amino]-1,3,4-thiadiazol-2-yl]octa-1,3-dienyl]amino]-2-methoxyethyl]phenyl]ethyl]-3-methylbutanamide |
|---|---|
| PubChem CID | 145168327 |
| Molecular Formula | C34H47N7O3S |
| Molecular Weight | 633.86 g/mol |
| Exact Mass | 633.35 |
| IUPAC Name | N-[1-[3-[2-[[(1E,3Z)-1,4-diamino-8-[5-[(2-phenylacetyl)amino]-1,3,4-thiadiazol-2-yl]octa-1,3-dienyl]amino]-2-methoxyethyl]phenyl]ethyl]-3-methylbutanamide |
| SMILES | COC(Cc1cccc(C(C)NC(=O)CC(C)C)c1)N/C(N)=C/C=C(\N)CCCCc1nnc(NC(=O)Cc2ccccc2)s1 |
| InChI | InChI=1S/C34H47N7O3S/c1-23(2)19-30(42)37-24(3)27-14-10-13-26(20-27)22-32(44-4)38-29(36)18-17-28(35)15-8-9-16-33-40-41-34(45-33)39-31(43)21-25-11-6-5-7-12-25/h5-7,10-14,17-18,20,23-24,32,38H,8-9,15-16,19,21-22,35-36H2,1-4H3,(H,37,42)(H,39,41,43)/b28-17-,29-18+ |
| InChIKey | HRLOPLVVRQHLOT-GQGQITAGSA-N |
| XLogP | 5.10 |
| TPSA | 157.28 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 633.86 |
| LogP ≤ 5 | 5.10 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|