C26H29ClN6O2S — CID 144641055
N-[5-[(5Z,7E)-5,8-diamino-8-[[2-(2-chlorophenyl)acetyl]amino]octa-5,7-dienyl]-1,3,4-thiadiazol-2-yl]-2-phenylacetamide (PubChem CID 144641055) has the molecular formula C26H29ClN6O2S and a molecular weight of 525.08 g/mol. Its IUPAC name is N-[5-[(5Z,7E)-5,8-diamino-8-[[2-(2-chlorophenyl)acetyl]amino]octa-5,7-dienyl]-1,3,4-thiadiazol-2-yl]-2-phenylacetamide.
| Compound Name | N-[5-[(5Z,7E)-5,8-diamino-8-[[2-(2-chlorophenyl)acetyl]amino]octa-5,7-dienyl]-1,3,4-thiadiazol-2-yl]-2-phenylacetamide |
|---|---|
| PubChem CID | 144641055 |
| Molecular Formula | C26H29ClN6O2S |
| Molecular Weight | 525.08 g/mol |
| Exact Mass | 524.18 |
| IUPAC Name | N-[5-[(5Z,7E)-5,8-diamino-8-[[2-(2-chlorophenyl)acetyl]amino]octa-5,7-dienyl]-1,3,4-thiadiazol-2-yl]-2-phenylacetamide |
| SMILES | N/C(=C\C=C(/N)NC(=O)Cc1ccccc1Cl)CCCCc1nnc(NC(=O)Cc2ccccc2)s1 |
| InChI | InChI=1S/C26H29ClN6O2S/c27-21-12-6-4-10-19(21)17-24(35)30-22(29)15-14-20(28)11-5-7-13-25-32-33-26(36-25)31-23(34)16-18-8-2-1-3-9-18/h1-4,6,8-10,12,14-15H,5,7,11,13,16-17,28-29H2,(H,30,35)(H,31,33,34)/b20-14-,22-15+ |
| InChIKey | GQDKPMLBOZIENQ-UAKSEAGPSA-N |
| XLogP | 4.09 |
| TPSA | 136.02 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 525.08 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|