C27H28F4N6O3S — CID 139499556
N-[(1E,3Z)-1,4-diamino-8-[5-[[2-(3-fluorophenyl)acetyl]amino]-1,3,4-thiadiazol-2-yl]octa-1,3-dienyl]-2-[3-(trifluoromethoxy)phenyl]acetamide (PubChem CID 139499556) has the molecular formula C27H28F4N6O3S and a molecular weight of 592.62 g/mol. Its IUPAC name is N-[(1E,3Z)-1,4-diamino-8-[5-[[2-(3-fluorophenyl)acetyl]amino]-1,3,4-thiadiazol-2-yl]octa-1,3-dienyl]-2-[3-(trifluoromethoxy)phenyl]acetamide.
| Compound Name | N-[(1E,3Z)-1,4-diamino-8-[5-[[2-(3-fluorophenyl)acetyl]amino]-1,3,4-thiadiazol-2-yl]octa-1,3-dienyl]-2-[3-(trifluoromethoxy)phenyl]acetamide |
|---|---|
| PubChem CID | 139499556 |
| Molecular Formula | C27H28F4N6O3S |
| Molecular Weight | 592.62 g/mol |
| Exact Mass | 592.19 |
| IUPAC Name | N-[(1E,3Z)-1,4-diamino-8-[5-[[2-(3-fluorophenyl)acetyl]amino]-1,3,4-thiadiazol-2-yl]octa-1,3-dienyl]-2-[3-(trifluoromethoxy)phenyl]acetamide |
| SMILES | N/C(=C\C=C(/N)NC(=O)Cc1cccc(OC(F)(F)F)c1)CCCCc1nnc(NC(=O)Cc2cccc(F)c2)s1 |
| InChI | InChI=1S/C27H28F4N6O3S/c28-19-7-3-5-17(13-19)15-24(39)35-26-37-36-25(41-26)10-2-1-8-20(32)11-12-22(33)34-23(38)16-18-6-4-9-21(14-18)40-27(29,30)31/h3-7,9,11-14H,1-2,8,10,15-16,32-33H2,(H,34,38)(H,35,37,39)/b20-11-,22-12+ |
| InChIKey | OPZOLHWUPLPDIL-NGWRHAPDSA-N |
| XLogP | 4.47 |
| TPSA | 145.25 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 592.62 |
| LogP ≤ 5 | 4.47 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|