C26H28F3N7O4S — CID 144629969
N-[5-[(5Z,7E)-5,8-diamino-8-[[2-[3-hydroxy-5-(trifluoromethoxy)phenyl]acetyl]amino]octa-5,7-dienyl]-1,3,4-thiadiazol-2-yl]-2-pyridin-2-ylacetamide (PubChem CID 144629969) has the molecular formula C26H28F3N7O4S and a molecular weight of 591.62 g/mol. Its IUPAC name is N-[5-[(5Z,7E)-5,8-diamino-8-[[2-[3-hydroxy-5-(trifluoromethoxy)phenyl]acetyl]amino]octa-5,7-dienyl]-1,3,4-thiadiazol-2-yl]-2-pyridin-2-ylacetamide.
| Compound Name | N-[5-[(5Z,7E)-5,8-diamino-8-[[2-[3-hydroxy-5-(trifluoromethoxy)phenyl]acetyl]amino]octa-5,7-dienyl]-1,3,4-thiadiazol-2-yl]-2-pyridin-2-ylacetamide |
|---|---|
| PubChem CID | 144629969 |
| Molecular Formula | C26H28F3N7O4S |
| Molecular Weight | 591.62 g/mol |
| Exact Mass | 591.19 |
| IUPAC Name | N-[5-[(5Z,7E)-5,8-diamino-8-[[2-[3-hydroxy-5-(trifluoromethoxy)phenyl]acetyl]amino]octa-5,7-dienyl]-1,3,4-thiadiazol-2-yl]-2-pyridin-2-ylacetamide |
| SMILES | N/C(=C\C=C(/N)NC(=O)Cc1cc(O)cc(OC(F)(F)F)c1)CCCCc1nnc(NC(=O)Cc2ccccn2)s1 |
| InChI | InChI=1S/C26H28F3N7O4S/c27-26(28,29)40-20-12-16(11-19(37)15-20)13-22(38)33-21(31)9-8-17(30)5-1-2-7-24-35-36-25(41-24)34-23(39)14-18-6-3-4-10-32-18/h3-4,6,8-12,15,37H,1-2,5,7,13-14,30-31H2,(H,33,38)(H,34,36,39)/b17-8-,21-9+ |
| InChIKey | ZPGKIRRQIKEUNF-PKWZWLFUSA-N |
| XLogP | 3.43 |
| TPSA | 178.37 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 591.62 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|