C24H27F3N8O3S — CID 146527348
(Z)-2-amino-3-[amino-[4-[5-[(2-pyridin-2-ylacetyl)amino]-1,3,4-thiadiazol-2-yl]butyl]amino]-N-[[3-(trifluoromethoxy)phenyl]methyl]prop-2-enamide (PubChem CID 146527348) has the molecular formula C24H27F3N8O3S and a molecular weight of 564.59 g/mol. Its IUPAC name is (Z)-2-amino-3-[amino-[4-[5-[(2-pyridin-2-ylacetyl)amino]-1,3,4-thiadiazol-2-yl]butyl]amino]-N-[[3-(trifluoromethoxy)phenyl]methyl]prop-2-enamide.
| Compound Name | (Z)-2-amino-3-[amino-[4-[5-[(2-pyridin-2-ylacetyl)amino]-1,3,4-thiadiazol-2-yl]butyl]amino]-N-[[3-(trifluoromethoxy)phenyl]methyl]prop-2-enamide |
|---|---|
| PubChem CID | 146527348 |
| Molecular Formula | C24H27F3N8O3S |
| Molecular Weight | 564.59 g/mol |
| Exact Mass | 564.19 |
| IUPAC Name | (Z)-2-amino-3-[amino-[4-[5-[(2-pyridin-2-ylacetyl)amino]-1,3,4-thiadiazol-2-yl]butyl]amino]-N-[[3-(trifluoromethoxy)phenyl]methyl]prop-2-enamide |
| SMILES | N/C(=C\N(N)CCCCc1nnc(NC(=O)Cc2ccccn2)s1)C(=O)NCc1cccc(OC(F)(F)F)c1 |
| InChI | InChI=1S/C24H27F3N8O3S/c25-24(26,27)38-18-8-5-6-16(12-18)14-31-22(37)19(28)15-35(29)11-4-2-9-21-33-34-23(39-21)32-20(36)13-17-7-1-3-10-30-17/h1,3,5-8,10,12,15H,2,4,9,11,13-14,28-29H2,(H,31,37)(H,32,34,36)/b19-15- |
| InChIKey | KURNJBAIEDYHRO-CYVLTUHYSA-N |
| XLogP | 2.63 |
| TPSA | 161.38 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 564.59 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|