C23H30F3N7O4S — CID 146527687
(Z)-2-amino-3-[amino-[4-[5-[[2-[3-(trifluoromethoxy)phenyl]acetyl]amino]-1,3,4-thiadiazol-2-yl]butyl]amino]-N-(oxolan-3-ylmethyl)prop-2-enamide (PubChem CID 146527687) has the molecular formula C23H30F3N7O4S and a molecular weight of 557.60 g/mol. Its IUPAC name is (Z)-2-amino-3-[amino-[4-[5-[[2-[3-(trifluoromethoxy)phenyl]acetyl]amino]-1,3,4-thiadiazol-2-yl]butyl]amino]-N-(oxolan-3-ylmethyl)prop-2-enamide.
| Compound Name | (Z)-2-amino-3-[amino-[4-[5-[[2-[3-(trifluoromethoxy)phenyl]acetyl]amino]-1,3,4-thiadiazol-2-yl]butyl]amino]-N-(oxolan-3-ylmethyl)prop-2-enamide |
|---|---|
| PubChem CID | 146527687 |
| Molecular Formula | C23H30F3N7O4S |
| Molecular Weight | 557.60 g/mol |
| Exact Mass | 557.20 |
| IUPAC Name | (Z)-2-amino-3-[amino-[4-[5-[[2-[3-(trifluoromethoxy)phenyl]acetyl]amino]-1,3,4-thiadiazol-2-yl]butyl]amino]-N-(oxolan-3-ylmethyl)prop-2-enamide |
| SMILES | N/C(=C\N(N)CCCCc1nnc(NC(=O)Cc2cccc(OC(F)(F)F)c2)s1)C(=O)NCC1CCOC1 |
| InChI | InChI=1S/C23H30F3N7O4S/c24-23(25,26)37-17-5-3-4-15(10-17)11-19(34)30-22-32-31-20(38-22)6-1-2-8-33(28)13-18(27)21(35)29-12-16-7-9-36-14-16/h3-5,10,13,16H,1-2,6-9,11-12,14,27-28H2,(H,29,35)(H,30,32,34)/b18-13- |
| InChIKey | KBFMCMAIBVVROY-AQTBWJFISA-N |
| XLogP | 2.07 |
| TPSA | 157.72 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 557.60 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|