C28H27F5N6O3S — CID 166654366
N-[6-[4-[5-[[2-(3,6-difluoro-5-methylcyclohexa-1,3-dien-1-yl)acetyl]amino]-1,3,4-thiadiazol-2-yl]butyl]pyridazin-3-yl]-2-[3-(trifluoromethoxy)phenyl]acetamide (PubChem CID 166654366) has the molecular formula C28H27F5N6O3S and a molecular weight of 622.62 g/mol. Its IUPAC name is N-[6-[4-[5-[[2-(3,6-difluoro-5-methylcyclohexa-1,3-dien-1-yl)acetyl]amino]-1,3,4-thiadiazol-2-yl]butyl]pyridazin-3-yl]-2-[3-(trifluoromethoxy)phenyl]acetamide.
| Compound Name | N-[6-[4-[5-[[2-(3,6-difluoro-5-methylcyclohexa-1,3-dien-1-yl)acetyl]amino]-1,3,4-thiadiazol-2-yl]butyl]pyridazin-3-yl]-2-[3-(trifluoromethoxy)phenyl]acetamide |
|---|---|
| PubChem CID | 166654366 |
| Molecular Formula | C28H27F5N6O3S |
| Molecular Weight | 622.62 g/mol |
| Exact Mass | 622.18 |
| IUPAC Name | N-[6-[4-[5-[[2-(3,6-difluoro-5-methylcyclohexa-1,3-dien-1-yl)acetyl]amino]-1,3,4-thiadiazol-2-yl]butyl]pyridazin-3-yl]-2-[3-(trifluoromethoxy)phenyl]acetamide |
| SMILES | CC1C=C(F)C=C(CC(=O)Nc2nnc(CCCCc3ccc(NC(=O)Cc4cccc(OC(F)(F)F)c4)nn3)s2)C1F |
| InChI | InChI=1S/C28H27F5N6O3S/c1-16-11-19(29)14-18(26(16)30)15-24(41)35-27-39-38-25(43-27)8-3-2-6-20-9-10-22(37-36-20)34-23(40)13-17-5-4-7-21(12-17)42-28(31,32)33/h4-5,7,9-12,14,16,26H,2-3,6,8,13,15H2,1H3,(H,34,37,40)(H,35,39,41) |
| InChIKey | LJCSJAROQDNCER-UHFFFAOYSA-N |
| XLogP | 6.07 |
| TPSA | 118.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 622.62 |
| LogP ≤ 5 | 6.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|