C18H20F3N5O2S — CID 142295007
N-[6-(5-hydrazinyl-5-sulfanylidenepentyl)pyridazin-3-yl]-2-[3-(trifluoromethoxy)phenyl]acetamide (PubChem CID 142295007) has the molecular formula C18H20F3N5O2S and a molecular weight of 427.45 g/mol. Its IUPAC name is N-[6-(5-hydrazinyl-5-sulfanylidenepentyl)pyridazin-3-yl]-2-[3-(trifluoromethoxy)phenyl]acetamide.
| Compound Name | N-[6-(5-hydrazinyl-5-sulfanylidenepentyl)pyridazin-3-yl]-2-[3-(trifluoromethoxy)phenyl]acetamide |
|---|---|
| PubChem CID | 142295007 |
| Molecular Formula | C18H20F3N5O2S |
| Molecular Weight | 427.45 g/mol |
| Exact Mass | 427.13 |
| IUPAC Name | N-[6-(5-hydrazinyl-5-sulfanylidenepentyl)pyridazin-3-yl]-2-[3-(trifluoromethoxy)phenyl]acetamide |
| SMILES | NNC(=S)CCCCc1ccc(NC(=O)Cc2cccc(OC(F)(F)F)c2)nn1 |
| InChI | InChI=1S/C18H20F3N5O2S/c19-18(20,21)28-14-6-3-4-12(10-14)11-16(27)23-15-9-8-13(25-26-15)5-1-2-7-17(29)24-22/h3-4,6,8-10H,1-2,5,7,11,22H2,(H,24,29)(H,23,26,27) |
| InChIKey | XPAATGZTYWYZEE-UHFFFAOYSA-N |
| XLogP | 3.06 |
| TPSA | 102.16 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.45 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|