C24H30F3N7O5 — CID 174047458
2-hydrazinylidene-N-[3-hydroxy-2-(hydroxymethyl)propyl]-3-[4-[6-[[2-[3-(trifluoromethoxy)phenyl]acetyl]amino]pyridazin-3-yl]butylimino]propanamide (PubChem CID 174047458) has the molecular formula C24H30F3N7O5 and a molecular weight of 553.54 g/mol. Its IUPAC name is 2-hydrazinylidene-N-[3-hydroxy-2-(hydroxymethyl)propyl]-3-[4-[6-[[2-[3-(trifluoromethoxy)phenyl]acetyl]amino]pyridazin-3-yl]butylimino]propanamide.
| Compound Name | 2-hydrazinylidene-N-[3-hydroxy-2-(hydroxymethyl)propyl]-3-[4-[6-[[2-[3-(trifluoromethoxy)phenyl]acetyl]amino]pyridazin-3-yl]butylimino]propanamide |
|---|---|
| PubChem CID | 174047458 |
| Molecular Formula | C24H30F3N7O5 |
| Molecular Weight | 553.54 g/mol |
| Exact Mass | 553.23 |
| IUPAC Name | 2-hydrazinylidene-N-[3-hydroxy-2-(hydroxymethyl)propyl]-3-[4-[6-[[2-[3-(trifluoromethoxy)phenyl]acetyl]amino]pyridazin-3-yl]butylimino]propanamide |
| SMILES | NN=C(/C=N/CCCCc1ccc(NC(=O)Cc2cccc(OC(F)(F)F)c2)nn1)C(=O)NCC(CO)CO |
| InChI | InChI=1S/C24H30F3N7O5/c25-24(26,27)39-19-6-3-4-16(10-19)11-22(37)31-21-8-7-18(33-34-21)5-1-2-9-29-13-20(32-28)23(38)30-12-17(14-35)15-36/h3-4,6-8,10,13,17,35-36H,1-2,5,9,11-12,14-15,28H2,(H,30,38)(H,31,34,37)/b29-13+,32-20? |
| InChIKey | VNWUEJXUYGKJIW-LFZYAUFPSA-N |
| XLogP | 0.98 |
| TPSA | 184.41 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 553.54 |
| LogP ≤ 5 | 0.98 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|