C25H27F3N6O6 — CID 118622171
2-methoxyethyl N-[2-oxo-1-[4-[6-[[2-[3-(trifluoromethoxy)phenyl]acetyl]amino]pyridazin-3-yl]butyl]pyrimidin-4-yl]carbamate (PubChem CID 118622171) has the molecular formula C25H27F3N6O6 and a molecular weight of 564.52 g/mol. Its IUPAC name is 2-methoxyethyl N-[2-oxo-1-[4-[6-[[2-[3-(trifluoromethoxy)phenyl]acetyl]amino]pyridazin-3-yl]butyl]pyrimidin-4-yl]carbamate.
| Compound Name | 2-methoxyethyl N-[2-oxo-1-[4-[6-[[2-[3-(trifluoromethoxy)phenyl]acetyl]amino]pyridazin-3-yl]butyl]pyrimidin-4-yl]carbamate |
|---|---|
| PubChem CID | 118622171 |
| Molecular Formula | C25H27F3N6O6 |
| Molecular Weight | 564.52 g/mol |
| Exact Mass | 564.19 |
| IUPAC Name | 2-methoxyethyl N-[2-oxo-1-[4-[6-[[2-[3-(trifluoromethoxy)phenyl]acetyl]amino]pyridazin-3-yl]butyl]pyrimidin-4-yl]carbamate |
| SMILES | COCCOC(=O)Nc1ccn(CCCCc2ccc(NC(=O)Cc3cccc(OC(F)(F)F)c3)nn2)c(=O)n1 |
| InChI | InChI=1S/C25H27F3N6O6/c1-38-13-14-39-24(37)31-20-10-12-34(23(36)30-20)11-3-2-6-18-8-9-21(33-32-18)29-22(35)16-17-5-4-7-19(15-17)40-25(26,27)28/h4-5,7-10,12,15H,2-3,6,11,13-14,16H2,1H3,(H,29,33,35)(H,30,31,36,37) |
| InChIKey | JFSLRJWYVJLVCT-UHFFFAOYSA-N |
| XLogP | 3.33 |
| TPSA | 146.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 564.52 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|