C29H31F3N6O5 — CID 144993323
benzyl N-[1-[(5Z,7E)-5,8-diamino-8-[[2-[3-(trifluoromethoxy)phenyl]acetyl]amino]octa-5,7-dienyl]-2-oxopyrimidin-4-yl]carbamate (PubChem CID 144993323) has the molecular formula C29H31F3N6O5 and a molecular weight of 600.60 g/mol. Its IUPAC name is benzyl N-[1-[(5Z,7E)-5,8-diamino-8-[[2-[3-(trifluoromethoxy)phenyl]acetyl]amino]octa-5,7-dienyl]-2-oxopyrimidin-4-yl]carbamate.
| Compound Name | benzyl N-[1-[(5Z,7E)-5,8-diamino-8-[[2-[3-(trifluoromethoxy)phenyl]acetyl]amino]octa-5,7-dienyl]-2-oxopyrimidin-4-yl]carbamate |
|---|---|
| PubChem CID | 144993323 |
| Molecular Formula | C29H31F3N6O5 |
| Molecular Weight | 600.60 g/mol |
| Exact Mass | 600.23 |
| IUPAC Name | benzyl N-[1-[(5Z,7E)-5,8-diamino-8-[[2-[3-(trifluoromethoxy)phenyl]acetyl]amino]octa-5,7-dienyl]-2-oxopyrimidin-4-yl]carbamate |
| SMILES | N/C(=C\C=C(/N)NC(=O)Cc1cccc(OC(F)(F)F)c1)CCCCn1ccc(NC(=O)OCc2ccccc2)nc1=O |
| InChI | InChI=1S/C29H31F3N6O5/c30-29(31,32)43-23-11-6-9-21(17-23)18-26(39)35-24(34)13-12-22(33)10-4-5-15-38-16-14-25(36-27(38)40)37-28(41)42-19-20-7-2-1-3-8-20/h1-3,6-9,11-14,16-17H,4-5,10,15,18-19,33-34H2,(H,35,39)(H,36,37,40,41)/b22-12-,24-13+ |
| InChIKey | BGSYNZFYYVUAOP-XWBDCVLISA-N |
| XLogP | 4.06 |
| TPSA | 163.59 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 43 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 600.60 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|