C26H26N6O4S — CID 118622598
benzyl N-[1-[4-[5-(benzylcarbamoyl)-1,3,4-thiadiazol-2-yl]butyl]-2-oxopyrimidin-4-yl]carbamate (PubChem CID 118622598) has the molecular formula C26H26N6O4S and a molecular weight of 518.60 g/mol. Its IUPAC name is benzyl N-[1-[4-[5-(benzylcarbamoyl)-1,3,4-thiadiazol-2-yl]butyl]-2-oxopyrimidin-4-yl]carbamate.
| Compound Name | benzyl N-[1-[4-[5-(benzylcarbamoyl)-1,3,4-thiadiazol-2-yl]butyl]-2-oxopyrimidin-4-yl]carbamate |
|---|---|
| PubChem CID | 118622598 |
| Molecular Formula | C26H26N6O4S |
| Molecular Weight | 518.60 g/mol |
| Exact Mass | 518.17 |
| IUPAC Name | benzyl N-[1-[4-[5-(benzylcarbamoyl)-1,3,4-thiadiazol-2-yl]butyl]-2-oxopyrimidin-4-yl]carbamate |
| SMILES | O=C(Nc1ccn(CCCCc2nnc(C(=O)NCc3ccccc3)s2)c(=O)n1)OCc1ccccc1 |
| InChI | InChI=1S/C26H26N6O4S/c33-23(27-17-19-9-3-1-4-10-19)24-31-30-22(37-24)13-7-8-15-32-16-14-21(28-25(32)34)29-26(35)36-18-20-11-5-2-6-12-20/h1-6,9-12,14,16H,7-8,13,15,17-18H2,(H,27,33)(H,28,29,34,35) |
| InChIKey | HBIRIZKFDVKAGI-UHFFFAOYSA-N |
| XLogP | 3.80 |
| TPSA | 128.10 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 518.60 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|