C19H23N5O5 — CID 71201669
benzyl N-[1-[2-[2-aminoethyl(2-oxopropyl)amino]-2-oxoethyl]-2-oxopyrimidin-4-yl]carbamate (PubChem CID 71201669) has the molecular formula C19H23N5O5 and a molecular weight of 401.42 g/mol. Its IUPAC name is benzyl N-[1-[2-[2-aminoethyl(2-oxopropyl)amino]-2-oxoethyl]-2-oxopyrimidin-4-yl]carbamate.
| Compound Name | benzyl N-[1-[2-[2-aminoethyl(2-oxopropyl)amino]-2-oxoethyl]-2-oxopyrimidin-4-yl]carbamate |
|---|---|
| PubChem CID | 71201669 |
| Molecular Formula | C19H23N5O5 |
| Molecular Weight | 401.42 g/mol |
| Exact Mass | 401.17 |
| IUPAC Name | benzyl N-[1-[2-[2-aminoethyl(2-oxopropyl)amino]-2-oxoethyl]-2-oxopyrimidin-4-yl]carbamate |
| SMILES | CC(=O)CN(CCN)C(=O)Cn1ccc(NC(=O)OCc2ccccc2)nc1=O |
| InChI | InChI=1S/C19H23N5O5/c1-14(25)11-23(10-8-20)17(26)12-24-9-7-16(21-18(24)27)22-19(28)29-13-15-5-3-2-4-6-15/h2-7,9H,8,10-13,20H2,1H3,(H,21,22,27,28) |
| InChIKey | ASNAHEOETPQLTH-UHFFFAOYSA-N |
| XLogP | 0.37 |
| TPSA | 136.62 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.42 |
| LogP ≤ 5 | 0.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |