C28H33N5O7 — CID 25266096
benzyl N-[3-[[2-(2,4-dioxopyrimidin-1-yl)acetyl]-[3-(phenylmethoxycarbonylamino)propyl]amino]propyl]carbamate (PubChem CID 25266096) has the molecular formula C28H33N5O7 and a molecular weight of 551.60 g/mol. Its IUPAC name is benzyl N-[3-[[2-(2,4-dioxopyrimidin-1-yl)acetyl]-[3-(phenylmethoxycarbonylamino)propyl]amino]propyl]carbamate.
| Compound Name | benzyl N-[3-[[2-(2,4-dioxopyrimidin-1-yl)acetyl]-[3-(phenylmethoxycarbonylamino)propyl]amino]propyl]carbamate |
|---|---|
| PubChem CID | 25266096 |
| Molecular Formula | C28H33N5O7 |
| Molecular Weight | 551.60 g/mol |
| Exact Mass | 551.24 |
| IUPAC Name | benzyl N-[3-[[2-(2,4-dioxopyrimidin-1-yl)acetyl]-[3-(phenylmethoxycarbonylamino)propyl]amino]propyl]carbamate |
| SMILES | O=C(NCCCN(CCCNC(=O)OCc1ccccc1)C(=O)Cn1ccc(=O)[nH]c1=O)OCc1ccccc1 |
| InChI | InChI=1S/C28H33N5O7/c34-24-13-18-33(26(36)31-24)19-25(35)32(16-7-14-29-27(37)39-20-22-9-3-1-4-10-22)17-8-15-30-28(38)40-21-23-11-5-2-6-12-23/h1-6,9-13,18H,7-8,14-17,19-21H2,(H,29,37)(H,30,38)(H,31,34,36) |
| InChIKey | PRDAJTFDVJTVSF-UHFFFAOYSA-N |
| XLogP | 2.00 |
| TPSA | 151.83 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 551.60 |
| LogP ≤ 5 | 2.00 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|