C22H27N7O5 — CID 11397230
tert-butyl (2R,4S)-4-azido-2-[[2-oxo-4-(phenylmethoxycarbonylamino)pyrimidin-1-yl]methyl]pyrrolidine-1-carboxylate (PubChem CID 11397230) has the molecular formula C22H27N7O5 and a molecular weight of 469.50 g/mol. Its IUPAC name is tert-butyl (2R,4S)-4-azido-2-[[2-oxo-4-(phenylmethoxycarbonylamino)pyrimidin-1-yl]methyl]pyrrolidine-1-carboxylate.
| Compound Name | tert-butyl (2R,4S)-4-azido-2-[[2-oxo-4-(phenylmethoxycarbonylamino)pyrimidin-1-yl]methyl]pyrrolidine-1-carboxylate |
|---|---|
| PubChem CID | 11397230 |
| Molecular Formula | C22H27N7O5 |
| Molecular Weight | 469.50 g/mol |
| Exact Mass | 469.21 |
| IUPAC Name | tert-butyl (2R,4S)-4-azido-2-[[2-oxo-4-(phenylmethoxycarbonylamino)pyrimidin-1-yl]methyl]pyrrolidine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1C[C@@H](N=[N+]=[N-])C[C@@H]1Cn1ccc(NC(=O)OCc2ccccc2)nc1=O |
| InChI | InChI=1S/C22H27N7O5/c1-22(2,3)34-21(32)29-12-16(26-27-23)11-17(29)13-28-10-9-18(24-19(28)30)25-20(31)33-14-15-7-5-4-6-8-15/h4-10,16-17H,11-14H2,1-3H3,(H,24,25,30,31)/t16-,17+/m0/s1 |
| InChIKey | SHXPSKGAOPWXJH-DLBZAZTESA-N |
| XLogP | 3.68 |
| TPSA | 151.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.50 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|