C10H17FN4O2 — CID 58303468
tert-butyl (2S,4R)-4-azido-2-(fluoromethyl)pyrrolidine-1-carboxylate (PubChem CID 58303468) has the molecular formula C10H17FN4O2 and a molecular weight of 244.27 g/mol. Its IUPAC name is tert-butyl (2S,4R)-4-azido-2-(fluoromethyl)pyrrolidine-1-carboxylate.
| Compound Name | tert-butyl (2S,4R)-4-azido-2-(fluoromethyl)pyrrolidine-1-carboxylate |
|---|---|
| PubChem CID | 58303468 |
| Molecular Formula | C10H17FN4O2 |
| Molecular Weight | 244.27 g/mol |
| Exact Mass | 244.13 |
| IUPAC Name | tert-butyl (2S,4R)-4-azido-2-(fluoromethyl)pyrrolidine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1C[C@H](N=[N+]=[N-])C[C@H]1CF |
| InChI | InChI=1S/C10H17FN4O2/c1-10(2,3)17-9(16)15-6-7(13-14-12)4-8(15)5-11/h7-8H,4-6H2,1-3H3/t7-,8+/m1/s1 |
| InChIKey | RBQAIZMMEJXMBI-SFYZADRCSA-N |
| XLogP | 2.64 |
| TPSA | 78.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.27 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|