C12H19N7O2 — CID 175594735
tert-butyl 4-azido-2-(1,2,4-triazol-1-ylmethyl)pyrrolidine-1-carboxylate (PubChem CID 175594735) has the molecular formula C12H19N7O2 and a molecular weight of 293.33 g/mol. Its IUPAC name is tert-butyl 4-azido-2-(1,2,4-triazol-1-ylmethyl)pyrrolidine-1-carboxylate.
| Compound Name | tert-butyl 4-azido-2-(1,2,4-triazol-1-ylmethyl)pyrrolidine-1-carboxylate |
|---|---|
| PubChem CID | 175594735 |
| Molecular Formula | C12H19N7O2 |
| Molecular Weight | 293.33 g/mol |
| Exact Mass | 293.16 |
| IUPAC Name | tert-butyl 4-azido-2-(1,2,4-triazol-1-ylmethyl)pyrrolidine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CC(N=[N+]=[N-])CC1Cn1cncn1 |
| InChI | InChI=1S/C12H19N7O2/c1-12(2,3)21-11(20)19-5-9(16-17-13)4-10(19)6-18-8-14-7-15-18/h7-10H,4-6H2,1-3H3 |
| InChIKey | LZWUCFIAQAPWPL-UHFFFAOYSA-N |
| XLogP | 1.97 |
| TPSA | 109.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.33 |
| LogP ≤ 5 | 1.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|