C20H28N4O3S — CID 55944795
benzyl N-[(2S)-3-methyl-1-oxo-1-[(5-pentyl-1,3,4-thiadiazol-2-yl)amino]butan-2-yl]carbamate (PubChem CID 55944795) has the molecular formula C20H28N4O3S and a molecular weight of 404.54 g/mol. Its IUPAC name is benzyl N-[(2S)-3-methyl-1-oxo-1-[(5-pentyl-1,3,4-thiadiazol-2-yl)amino]butan-2-yl]carbamate.
| Compound Name | benzyl N-[(2S)-3-methyl-1-oxo-1-[(5-pentyl-1,3,4-thiadiazol-2-yl)amino]butan-2-yl]carbamate |
|---|---|
| PubChem CID | 55944795 |
| Molecular Formula | C20H28N4O3S |
| Molecular Weight | 404.54 g/mol |
| Exact Mass | 404.19 |
| IUPAC Name | benzyl N-[(2S)-3-methyl-1-oxo-1-[(5-pentyl-1,3,4-thiadiazol-2-yl)amino]butan-2-yl]carbamate |
| SMILES | CCCCCc1nnc(NC(=O)[C@@H](NC(=O)OCc2ccccc2)C(C)C)s1 |
| InChI | InChI=1S/C20H28N4O3S/c1-4-5-7-12-16-23-24-19(28-16)22-18(25)17(14(2)3)21-20(26)27-13-15-10-8-6-9-11-15/h6,8-11,14,17H,4-5,7,12-13H2,1-3H3,(H,21,26)(H,22,24,25)/t17-/m0/s1 |
| InChIKey | ABDMNCYXMPSATE-KRWDZBQOSA-N |
| XLogP | 4.16 |
| TPSA | 93.21 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.54 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|