C20H21N3OS — CID 5040744
N-(5-butyl-1,3,4-thiadiazol-2-yl)-2,2-diphenylacetamide (PubChem CID 5040744) has the molecular formula C20H21N3OS and a molecular weight of 351.48 g/mol. Its IUPAC name is N-(5-butyl-1,3,4-thiadiazol-2-yl)-2,2-diphenylacetamide.
| Compound Name | N-(5-butyl-1,3,4-thiadiazol-2-yl)-2,2-diphenylacetamide |
|---|---|
| PubChem CID | 5040744 |
| Molecular Formula | C20H21N3OS |
| Molecular Weight | 351.48 g/mol |
| Exact Mass | 351.14 |
| IUPAC Name | N-(5-butyl-1,3,4-thiadiazol-2-yl)-2,2-diphenylacetamide |
| SMILES | CCCCc1nnc(NC(=O)C(c2ccccc2)c2ccccc2)s1 |
| InChI | InChI=1S/C20H21N3OS/c1-2-3-14-17-22-23-20(25-17)21-19(24)18(15-10-6-4-7-11-15)16-12-8-5-9-13-16/h4-13,18H,2-3,14H2,1H3,(H,21,23,24) |
| InChIKey | DCPKMFOWPXXKPZ-UHFFFAOYSA-N |
| XLogP | 4.65 |
| TPSA | 54.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.48 |
| LogP ≤ 5 | 4.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |