C12H14N4OS — CID 19224251
N-(5-butyl-1,3,4-thiadiazol-2-yl)pyridine-2-carboxamide (PubChem CID 19224251) has the molecular formula C12H14N4OS and a molecular weight of 262.34 g/mol. Its IUPAC name is N-(5-butyl-1,3,4-thiadiazol-2-yl)pyridine-2-carboxamide.
| Compound Name | N-(5-butyl-1,3,4-thiadiazol-2-yl)pyridine-2-carboxamide |
|---|---|
| PubChem CID | 19224251 |
| Molecular Formula | C12H14N4OS |
| Molecular Weight | 262.34 g/mol |
| Exact Mass | 262.09 |
| IUPAC Name | N-(5-butyl-1,3,4-thiadiazol-2-yl)pyridine-2-carboxamide |
| SMILES | CCCCc1nnc(NC(=O)c2ccccn2)s1 |
| InChI | InChI=1S/C12H14N4OS/c1-2-3-7-10-15-16-12(18-10)14-11(17)9-6-4-5-8-13-9/h4-6,8H,2-3,7H2,1H3,(H,14,16,17) |
| InChIKey | MSZQKZWERZRQMG-UHFFFAOYSA-N |
| XLogP | 2.53 |
| TPSA | 67.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.34 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |