C16H16N4OS — CID 26197186
N-(5-butyl-1,3,4-thiadiazol-2-yl)quinoline-2-carboxamide (PubChem CID 26197186) has the molecular formula C16H16N4OS and a molecular weight of 312.40 g/mol. Its IUPAC name is N-(5-butyl-1,3,4-thiadiazol-2-yl)quinoline-2-carboxamide.
| Compound Name | N-(5-butyl-1,3,4-thiadiazol-2-yl)quinoline-2-carboxamide |
|---|---|
| PubChem CID | 26197186 |
| Molecular Formula | C16H16N4OS |
| Molecular Weight | 312.40 g/mol |
| Exact Mass | 312.10 |
| IUPAC Name | N-(5-butyl-1,3,4-thiadiazol-2-yl)quinoline-2-carboxamide |
| SMILES | CCCCc1nnc(NC(=O)c2ccc3ccccc3n2)s1 |
| InChI | InChI=1S/C16H16N4OS/c1-2-3-8-14-19-20-16(22-14)18-15(21)13-10-9-11-6-4-5-7-12(11)17-13/h4-7,9-10H,2-3,8H2,1H3,(H,18,20,21) |
| InChIKey | XQZCZZJXHRYJTE-UHFFFAOYSA-N |
| XLogP | 3.68 |
| TPSA | 67.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.40 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |