C15H13N3OS — CID 17399707
N-(4,5-dimethyl-1,3-thiazol-2-yl)quinoline-2-carboxamide (PubChem CID 17399707) has the molecular formula C15H13N3OS and a molecular weight of 283.36 g/mol. Its IUPAC name is N-(4,5-dimethyl-1,3-thiazol-2-yl)quinoline-2-carboxamide.
| Compound Name | N-(4,5-dimethyl-1,3-thiazol-2-yl)quinoline-2-carboxamide |
|---|---|
| PubChem CID | 17399707 |
| Molecular Formula | C15H13N3OS |
| Molecular Weight | 283.36 g/mol |
| Exact Mass | 283.08 |
| IUPAC Name | N-(4,5-dimethyl-1,3-thiazol-2-yl)quinoline-2-carboxamide |
| SMILES | Cc1nc(NC(=O)c2ccc3ccccc3n2)sc1C |
| InChI | InChI=1S/C15H13N3OS/c1-9-10(2)20-15(16-9)18-14(19)13-8-7-11-5-3-4-6-12(11)17-13/h3-8H,1-2H3,(H,16,18,19) |
| InChIKey | GRBXFIBSJIXVCS-UHFFFAOYSA-N |
| XLogP | 3.56 |
| TPSA | 54.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.36 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |