C16H13N3O3S — CID 38986621
methyl 2-[2-(quinoline-2-carbonylamino)-1,3-thiazol-4-yl]acetate (PubChem CID 38986621) has the molecular formula C16H13N3O3S and a molecular weight of 327.37 g/mol. Its IUPAC name is methyl 2-[2-(quinoline-2-carbonylamino)-1,3-thiazol-4-yl]acetate.
| Compound Name | methyl 2-[2-(quinoline-2-carbonylamino)-1,3-thiazol-4-yl]acetate |
|---|---|
| PubChem CID | 38986621 |
| Molecular Formula | C16H13N3O3S |
| Molecular Weight | 327.37 g/mol |
| Exact Mass | 327.07 |
| IUPAC Name | methyl 2-[2-(quinoline-2-carbonylamino)-1,3-thiazol-4-yl]acetate |
| SMILES | COC(=O)Cc1csc(NC(=O)c2ccc3ccccc3n2)n1 |
| InChI | InChI=1S/C16H13N3O3S/c1-22-14(20)8-11-9-23-16(17-11)19-15(21)13-7-6-10-4-2-3-5-12(10)18-13/h2-7,9H,8H2,1H3,(H,17,19,21) |
| InChIKey | XTZUEHVALFCTOF-UHFFFAOYSA-N |
| XLogP | 2.66 |
| TPSA | 81.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.37 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |