C13H12N2O5S — CID 107725368
methyl 2-[2-[(2,5-dihydroxybenzoyl)amino]-1,3-thiazol-4-yl]acetate (PubChem CID 107725368) has the molecular formula C13H12N2O5S and a molecular weight of 308.31 g/mol. Its IUPAC name is methyl 2-[2-[(2,5-dihydroxybenzoyl)amino]-1,3-thiazol-4-yl]acetate.
| Compound Name | methyl 2-[2-[(2,5-dihydroxybenzoyl)amino]-1,3-thiazol-4-yl]acetate |
|---|---|
| PubChem CID | 107725368 |
| Molecular Formula | C13H12N2O5S |
| Molecular Weight | 308.31 g/mol |
| Exact Mass | 308.05 |
| IUPAC Name | methyl 2-[2-[(2,5-dihydroxybenzoyl)amino]-1,3-thiazol-4-yl]acetate |
| SMILES | COC(=O)Cc1csc(NC(=O)c2cc(O)ccc2O)n1 |
| InChI | InChI=1S/C13H12N2O5S/c1-20-11(18)4-7-6-21-13(14-7)15-12(19)9-5-8(16)2-3-10(9)17/h2-3,5-6,16-17H,4H2,1H3,(H,14,15,19) |
| InChIKey | ZBEIJAIRIAYQBV-UHFFFAOYSA-N |
| XLogP | 1.52 |
| TPSA | 108.75 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.31 |
| LogP ≤ 5 | 1.52 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|