C21H20N2O4S — CID 60620637
ethyl 2-[2-[(5-benzyl-2-hydroxybenzoyl)amino]-1,3-thiazol-4-yl]acetate (PubChem CID 60620637) has the molecular formula C21H20N2O4S and a molecular weight of 396.47 g/mol. Its IUPAC name is ethyl 2-[2-[(5-benzyl-2-hydroxybenzoyl)amino]-1,3-thiazol-4-yl]acetate.
| Compound Name | ethyl 2-[2-[(5-benzyl-2-hydroxybenzoyl)amino]-1,3-thiazol-4-yl]acetate |
|---|---|
| PubChem CID | 60620637 |
| Molecular Formula | C21H20N2O4S |
| Molecular Weight | 396.47 g/mol |
| Exact Mass | 396.11 |
| IUPAC Name | ethyl 2-[2-[(5-benzyl-2-hydroxybenzoyl)amino]-1,3-thiazol-4-yl]acetate |
| SMILES | CCOC(=O)Cc1csc(NC(=O)c2cc(Cc3ccccc3)ccc2O)n1 |
| InChI | InChI=1S/C21H20N2O4S/c1-2-27-19(25)12-16-13-28-21(22-16)23-20(26)17-11-15(8-9-18(17)24)10-14-6-4-3-5-7-14/h3-9,11,13,24H,2,10,12H2,1H3,(H,22,23,26) |
| InChIKey | MZEUGQUGNBNIAU-UHFFFAOYSA-N |
| XLogP | 3.80 |
| TPSA | 88.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.47 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |