C14H12F2N2O3S — CID 60620680
ethyl 2-[2-[(2,3-difluorobenzoyl)amino]-1,3-thiazol-4-yl]acetate (PubChem CID 60620680) has the molecular formula C14H12F2N2O3S and a molecular weight of 326.32 g/mol. Its IUPAC name is ethyl 2-[2-[(2,3-difluorobenzoyl)amino]-1,3-thiazol-4-yl]acetate.
| Compound Name | ethyl 2-[2-[(2,3-difluorobenzoyl)amino]-1,3-thiazol-4-yl]acetate |
|---|---|
| PubChem CID | 60620680 |
| Molecular Formula | C14H12F2N2O3S |
| Molecular Weight | 326.32 g/mol |
| Exact Mass | 326.05 |
| IUPAC Name | ethyl 2-[2-[(2,3-difluorobenzoyl)amino]-1,3-thiazol-4-yl]acetate |
| SMILES | CCOC(=O)Cc1csc(NC(=O)c2cccc(F)c2F)n1 |
| InChI | InChI=1S/C14H12F2N2O3S/c1-2-21-11(19)6-8-7-22-14(17-8)18-13(20)9-4-3-5-10(15)12(9)16/h3-5,7H,2,6H2,1H3,(H,17,18,20) |
| InChIKey | CSHGJUILTFDBCC-UHFFFAOYSA-N |
| XLogP | 2.78 |
| TPSA | 68.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.32 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |