C14H14N2O3S — CID 35569810
methyl 2-[2-[(3-methylbenzoyl)amino]-1,3-thiazol-4-yl]acetate (PubChem CID 35569810) has the molecular formula C14H14N2O3S and a molecular weight of 290.34 g/mol. Its IUPAC name is methyl 2-[2-[(3-methylbenzoyl)amino]-1,3-thiazol-4-yl]acetate.
| Compound Name | methyl 2-[2-[(3-methylbenzoyl)amino]-1,3-thiazol-4-yl]acetate |
|---|---|
| PubChem CID | 35569810 |
| Molecular Formula | C14H14N2O3S |
| Molecular Weight | 290.34 g/mol |
| Exact Mass | 290.07 |
| IUPAC Name | methyl 2-[2-[(3-methylbenzoyl)amino]-1,3-thiazol-4-yl]acetate |
| SMILES | COC(=O)Cc1csc(NC(=O)c2cccc(C)c2)n1 |
| InChI | InChI=1S/C14H14N2O3S/c1-9-4-3-5-10(6-9)13(18)16-14-15-11(8-20-14)7-12(17)19-2/h3-6,8H,7H2,1-2H3,(H,15,16,18) |
| InChIKey | HRMLEDXXOPSPAN-UHFFFAOYSA-N |
| XLogP | 2.42 |
| TPSA | 68.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.34 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |