C15H15N5OS2 — CID 46579335
3-methyl-N-[4-[(4-methyl-5-sulfanylidene-1H-1,2,4-triazol-3-yl)methyl]-1,3-thiazol-2-yl]benzamide (PubChem CID 46579335) has the molecular formula C15H15N5OS2 and a molecular weight of 345.45 g/mol. Its IUPAC name is 3-methyl-N-[4-[(4-methyl-5-sulfanylidene-1H-1,2,4-triazol-3-yl)methyl]-1,3-thiazol-2-yl]benzamide.
| Compound Name | 3-methyl-N-[4-[(4-methyl-5-sulfanylidene-1H-1,2,4-triazol-3-yl)methyl]-1,3-thiazol-2-yl]benzamide |
|---|---|
| PubChem CID | 46579335 |
| Molecular Formula | C15H15N5OS2 |
| Molecular Weight | 345.45 g/mol |
| Exact Mass | 345.07 |
| IUPAC Name | 3-methyl-N-[4-[(4-methyl-5-sulfanylidene-1H-1,2,4-triazol-3-yl)methyl]-1,3-thiazol-2-yl]benzamide |
| SMILES | Cc1cccc(C(=O)Nc2nc(Cc3n[nH]c(=S)n3C)cs2)c1 |
| InChI | InChI=1S/C15H15N5OS2/c1-9-4-3-5-10(6-9)13(21)17-14-16-11(8-23-14)7-12-18-19-15(22)20(12)2/h3-6,8H,7H2,1-2H3,(H,19,22)(H,16,17,21) |
| InChIKey | SRVQINLZTVZJIA-UHFFFAOYSA-N |
| XLogP | 3.09 |
| TPSA | 75.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.45 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|