C18H20N6O2S2 — CID 56578316
N-[4-[2-[2-(4-ethyl-5-sulfanylidene-1H-1,2,4-triazol-3-yl)ethylamino]-2-oxoethyl]-1,3-thiazol-2-yl]benzamide (PubChem CID 56578316) has the molecular formula C18H20N6O2S2 and a molecular weight of 416.53 g/mol. Its IUPAC name is N-[4-[2-[2-(4-ethyl-5-sulfanylidene-1H-1,2,4-triazol-3-yl)ethylamino]-2-oxoethyl]-1,3-thiazol-2-yl]benzamide.
| Compound Name | N-[4-[2-[2-(4-ethyl-5-sulfanylidene-1H-1,2,4-triazol-3-yl)ethylamino]-2-oxoethyl]-1,3-thiazol-2-yl]benzamide |
|---|---|
| PubChem CID | 56578316 |
| Molecular Formula | C18H20N6O2S2 |
| Molecular Weight | 416.53 g/mol |
| Exact Mass | 416.11 |
| IUPAC Name | N-[4-[2-[2-(4-ethyl-5-sulfanylidene-1H-1,2,4-triazol-3-yl)ethylamino]-2-oxoethyl]-1,3-thiazol-2-yl]benzamide |
| SMILES | CCn1c(CCNC(=O)Cc2csc(NC(=O)c3ccccc3)n2)n[nH]c1=S |
| InChI | InChI=1S/C18H20N6O2S2/c1-2-24-14(22-23-18(24)27)8-9-19-15(25)10-13-11-28-17(20-13)21-16(26)12-6-4-3-5-7-12/h3-7,11H,2,8-10H2,1H3,(H,19,25)(H,23,27)(H,20,21,26) |
| InChIKey | NZRXACHLKKWJSX-UHFFFAOYSA-N |
| XLogP | 2.57 |
| TPSA | 104.70 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.53 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|